C22H34O2 — CID 142561507
ethene;(17S)-13-ethyl-17-hydroxy-17-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 142561507) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is ethene;(17S)-13-ethyl-17-hydroxy-17-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | ethene;(17S)-13-ethyl-17-hydroxy-17-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 142561507 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | ethene;(17S)-13-ethyl-17-hydroxy-17-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C.CCC12CCC3C4CCC(=O)C=C4CCC3C1CC[C@]2(C)O |
| InChI | InChI=1S/C20H30O2.C2H4/c1-3-20-11-8-16-15-7-5-14(21)12-13(15)4-6-17(16)18(20)9-10-19(20,2)22;1-2/h12,15-18,22H,3-11H2,1-2H3;1-2H2/t15?,16?,17?,18?,19-,20?;/m0./s1 |
| InChIKey | GJYWFRCKABUDFZ-FMUOOHASSA-N |
| XLogP | 5.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|