About 1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane
1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane (PubChem CID 142561958) has the molecular formula C10H19F2NO2
and a molecular weight of 223.26 g/mol. Its IUPAC name is 1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane.
Molecular Properties
| Compound Name | 1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane |
| PubChem CID | 142561958 |
| Molecular Formula | C10H19F2NO2 |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane |
| SMILES | CCC.O=C(CO)N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C7H11F2NO2.C3H8/c8-7(9)2-1-3-10(5-7)6(12)4-11;1-3-2/h11H,1-5H2;3H2,1-2H3 |
| InChIKey | VYBBALZCUZYRPD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane?
The IUPAC name of 1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane (CID 142561958) is 1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane.
What is the SMILES notation for 1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane?
The canonical SMILES for 1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane is CCC.O=C(CO)N1CCCC(F)(F)C1.
What is the InChIKey of 1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane?
The InChIKey is VYBBALZCUZYRPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO2.C3H8/c8-7(9)2-1-3-10(5-7)6(12)4-11;1-3-2/h11H,1-5H2;3H2,1-2H3.
What are the key properties of 1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane?
1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane has a molecular weight of 223.26 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluoropiperidin-1-yl)-2-hydroxyethanone;propane is sourced from PubChem (CID 142561958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).