About (2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane
(2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane (PubChem CID 142562134) has the molecular formula C10H19F2NO2
and a molecular weight of 223.26 g/mol. Its IUPAC name is (2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane.
Molecular Properties
| Compound Name | (2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane |
| PubChem CID | 142562134 |
| Molecular Formula | C10H19F2NO2 |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane |
| SMILES | CC.C[C@H](O)C(=O)N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C8H13F2NO2.C2H6/c1-6(12)7(13)11-4-2-3-8(9,10)5-11;1-2/h6,12H,2-5H2,1H3;1-2H3/t6-;/m0./s1 |
| InChIKey | SPPVIKUJVSEWJC-RGMNGODLSA-N |
| XLogP | 1.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane?
The IUPAC name of (2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane (CID 142562134) is (2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane.
What is the SMILES notation for (2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane?
The canonical SMILES for (2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane is CC.C[C@H](O)C(=O)N1CCCC(F)(F)C1.
What is the InChIKey of (2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane?
The InChIKey is SPPVIKUJVSEWJC-RGMNGODLSA-N. The full InChI is InChI=1S/C8H13F2NO2.C2H6/c1-6(12)7(13)11-4-2-3-8(9,10)5-11;1-2/h6,12H,2-5H2,1H3;1-2H3/t6-;/m0./s1.
What are the key properties of (2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane?
(2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane has a molecular weight of 223.26 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(3,3-difluoropiperidin-1-yl)-2-hydroxypropan-1-one;ethane is sourced from PubChem (CID 142562134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).