C18H26N2 — CID 142562424
1-butyl-4,5-dimethyl-2-(2,4,6-trimethylphenyl)imidazole (PubChem CID 142562424) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-butyl-4,5-dimethyl-2-(2,4,6-trimethylphenyl)imidazole.
| Compound Name | 1-butyl-4,5-dimethyl-2-(2,4,6-trimethylphenyl)imidazole |
|---|---|
| PubChem CID | 142562424 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 1-butyl-4,5-dimethyl-2-(2,4,6-trimethylphenyl)imidazole |
| SMILES | CCCCn1c(-c2c(C)cc(C)cc2C)nc(C)c1C |
| InChI | InChI=1S/C18H26N2/c1-7-8-9-20-16(6)15(5)19-18(20)17-13(3)10-12(2)11-14(17)4/h10-11H,7-9H2,1-6H3 |
| InChIKey | WEZPDCPKPJUQBL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |