About 4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine
4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine (PubChem CID 142562572) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine.
Molecular Properties
| Compound Name | 4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine |
| PubChem CID | 142562572 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine |
| SMILES | C=C/C(=C\C=C(C)C)N1CCC(OC)CC1 |
| InChI | InChI=1S/C14H23NO/c1-5-13(7-6-12(2)3)15-10-8-14(16-4)9-11-15/h5-7,14H,1,8-11H2,2-4H3/b13-7+ |
| InChIKey | LBDIXXIQVMTUEA-NTUHNPAUSA-N |
| XLogP | 3.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine?
The IUPAC name of 4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine (CID 142562572) is 4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine.
What is the SMILES notation for 4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine?
The canonical SMILES for 4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine is C=C/C(=C\C=C(C)C)N1CCC(OC)CC1.
What is the InChIKey of 4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine?
The InChIKey is LBDIXXIQVMTUEA-NTUHNPAUSA-N. The full InChI is InChI=1S/C14H23NO/c1-5-13(7-6-12(2)3)15-10-8-14(16-4)9-11-15/h5-7,14H,1,8-11H2,2-4H3/b13-7+.
What are the key properties of 4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine?
4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine has a molecular weight of 221.34 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine is sourced from PubChem (CID 142562572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).