C28H36N6O — CID 142563291
cyclopropyl-[4-[2-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]piperazin-1-yl]methanone (PubChem CID 142563291) has the molecular formula C28H36N6O and a molecular weight of 472.64 g/mol. Its IUPAC name is cyclopropyl-[4-[2-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]piperazin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[2-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 142563291 |
| Molecular Formula | C28H36N6O |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | cyclopropyl-[4-[2-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]piperazin-1-yl]methanone |
| SMILES | CC(C)N1CCN(c2ccc(-c3cc4c(N5CCN(C(=O)C6CC6)CC5)ccnc4[nH]3)cc2)CC1 |
| InChI | InChI=1S/C28H36N6O/c1-20(2)31-11-13-32(14-12-31)23-7-5-21(6-8-23)25-19-24-26(9-10-29-27(24)30-25)33-15-17-34(18-16-33)28(35)22-3-4-22/h5-10,19-20,22H,3-4,11-18H2,1-2H3,(H,29,30) |
| InChIKey | RFKAMPXCZLSXFV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|