C26H33FN2O4 — CID 142563505
2-[5-amino-1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-fluoroindol-2-yl]-2-methylpropanal;methoxymethylbenzene (PubChem CID 142563505) has the molecular formula C26H33FN2O4 and a molecular weight of 456.56 g/mol. Its IUPAC name is 2-[5-amino-1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-fluoroindol-2-yl]-2-methylpropanal;methoxymethylbenzene.
| Compound Name | 2-[5-amino-1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-fluoroindol-2-yl]-2-methylpropanal;methoxymethylbenzene |
|---|---|
| PubChem CID | 142563505 |
| Molecular Formula | C26H33FN2O4 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 2-[5-amino-1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-fluoroindol-2-yl]-2-methylpropanal;methoxymethylbenzene |
| SMILES | CC1(C)OCC(Cn2c(C(C)(C)C=O)cc3cc(N)c(F)cc32)O1.COCc1ccccc1 |
| InChI | InChI=1S/C18H23FN2O3.C8H10O/c1-17(2,10-22)16-6-11-5-14(20)13(19)7-15(11)21(16)8-12-9-23-18(3,4)24-12;1-9-7-8-5-3-2-4-6-8/h5-7,10,12H,8-9,20H2,1-4H3;2-6H,7H2,1H3 |
| InChIKey | IXHOJAJGARTBSW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|