C21H23N3O5 — CID 142563865
[1-[4-(benzotriazol-2-yl)-3-hydroxyphenoxy]-3-ethoxypropan-2-yl] 2-methylprop-2-enoate (PubChem CID 142563865) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is [1-[4-(benzotriazol-2-yl)-3-hydroxyphenoxy]-3-ethoxypropan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-[4-(benzotriazol-2-yl)-3-hydroxyphenoxy]-3-ethoxypropan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142563865 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | [1-[4-(benzotriazol-2-yl)-3-hydroxyphenoxy]-3-ethoxypropan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(COCC)COc1ccc(-n2nc3ccccc3n2)c(O)c1 |
| InChI | InChI=1S/C21H23N3O5/c1-4-27-12-16(29-21(26)14(2)3)13-28-15-9-10-19(20(25)11-15)24-22-17-7-5-6-8-18(17)23-24/h5-11,16,25H,2,4,12-13H2,1,3H3 |
| InChIKey | XKSJTYRCLLVOKL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|