C24H26ClF3N7O3+ — CID 142564789
(Z)-[amino-(4-chlorophenyl)methylidene]-[[1-[2-[ethyl(methyl)carbamoyl]phenyl]-1,2,4-triazol-3-yl]methylcarbamoyl]-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium (PubChem CID 142564789) has the molecular formula C24H26ClF3N7O3+ and a molecular weight of 552.97 g/mol. Its IUPAC name is (Z)-[amino-(4-chlorophenyl)methylidene]-[[1-[2-[ethyl(methyl)carbamoyl]phenyl]-1,2,4-triazol-3-yl]methylcarbamoyl]-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium.
| Compound Name | (Z)-[amino-(4-chlorophenyl)methylidene]-[[1-[2-[ethyl(methyl)carbamoyl]phenyl]-1,2,4-triazol-3-yl]methylcarbamoyl]-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 142564789 |
| Molecular Formula | C24H26ClF3N7O3+ |
| Molecular Weight | 552.97 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | (Z)-[amino-(4-chlorophenyl)methylidene]-[[1-[2-[ethyl(methyl)carbamoyl]phenyl]-1,2,4-triazol-3-yl]methylcarbamoyl]-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium |
| SMILES | CCN(C)C(=O)c1ccccc1-n1cnc(CNC(=O)/[N+](C[C@H](O)C(F)(F)F)=C(\N)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C24H25ClF3N7O3/c1-3-33(2)22(37)17-6-4-5-7-18(17)35-14-31-20(32-35)12-30-23(38)34(13-19(36)24(26,27)28)21(29)15-8-10-16(25)11-9-15/h4-11,14,19,29,36H,3,12-13H2,1-2H3,(H,30,38)/p+1/t19-/m0/s1 |
| InChIKey | IWNXBNGTEWNGQT-IBGZPJMESA-O |
| XLogP | 2.56 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.97 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|