C17H20N4O5 — CID 142564812
2-[11-ethyl-2,6-dioxo-5-(oxolan-2-ylmethyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetic acid (PubChem CID 142564812) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-[11-ethyl-2,6-dioxo-5-(oxolan-2-ylmethyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetic acid.
| Compound Name | 2-[11-ethyl-2,6-dioxo-5-(oxolan-2-ylmethyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetic acid |
|---|---|
| PubChem CID | 142564812 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-[11-ethyl-2,6-dioxo-5-(oxolan-2-ylmethyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetic acid |
| SMILES | CCc1cc2n(CC(=O)O)c3c(c(=O)n2n1)CN(CC1CCCO1)C3=O |
| InChI | InChI=1S/C17H20N4O5/c1-2-10-6-13-20(9-14(22)23)15-12(16(24)21(13)18-10)8-19(17(15)25)7-11-4-3-5-26-11/h6,11H,2-5,7-9H2,1H3,(H,22,23) |
| InChIKey | MTFOIPGDCFFGHW-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |