C16H22N4O3 — CID 142564918
11-tert-butyl-5-[(2R)-1-methoxypropan-2-yl]-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione (PubChem CID 142564918) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 11-tert-butyl-5-[(2R)-1-methoxypropan-2-yl]-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione.
| Compound Name | 11-tert-butyl-5-[(2R)-1-methoxypropan-2-yl]-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
|---|---|
| PubChem CID | 142564918 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 11-tert-butyl-5-[(2R)-1-methoxypropan-2-yl]-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
| SMILES | COC[C@@H](C)N1Cc2c(nc3cc(C(C)(C)C)[nH]n3c2=O)C1=O |
| InChI | InChI=1S/C16H22N4O3/c1-9(8-23-5)19-7-10-13(15(19)22)17-12-6-11(16(2,3)4)18-20(12)14(10)21/h6,9,18H,7-8H2,1-5H3/t9-/m1/s1 |
| InChIKey | YNMPGGLJBFOLOZ-SECBINFHSA-N |
| XLogP | 1.31 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |