About 2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium
2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium (PubChem CID 142565319) has the molecular formula C8H18N3+
and a molecular weight of 156.25 g/mol. Its IUPAC name is 2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium.
Molecular Properties
| Compound Name | 2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium |
| PubChem CID | 142565319 |
| Molecular Formula | C8H18N3+ |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium |
| SMILES | C/C=C(\C=C/[NH2+]CCN)NC |
| InChI | InChI=1S/C8H17N3/c1-3-8(10-2)4-6-11-7-5-9/h3-4,6,10-11H,5,7,9H2,1-2H3/p+1/b6-4-,8-3+ |
| InChIKey | PUASEDHFEJOIDG-MROOEUIUSA-O |
| XLogP | -0.85 |
| TPSA | 54.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium?
The IUPAC name of 2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium (CID 142565319) is 2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium.
What is the SMILES notation for 2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium?
The canonical SMILES for 2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium is C/C=C(\C=C/[NH2+]CCN)NC.
What is the InChIKey of 2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium?
The InChIKey is PUASEDHFEJOIDG-MROOEUIUSA-O. The full InChI is InChI=1S/C8H17N3/c1-3-8(10-2)4-6-11-7-5-9/h3-4,6,10-11H,5,7,9H2,1-2H3/p+1/b6-4-,8-3+.
What are the key properties of 2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium?
2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium has a molecular weight of 156.25 g/mol, XLogP of -0.85, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl-[(1Z,3E)-3-(methylamino)penta-1,3-dienyl]azanium is sourced from PubChem (CID 142565319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).