About methane;2-methyl-1,3-thiazole-5-carbonitrile;propane
methane;2-methyl-1,3-thiazole-5-carbonitrile;propane (PubChem CID 142565775) has the molecular formula C9H16N2S
and a molecular weight of 184.31 g/mol. Its IUPAC name is methane;2-methyl-1,3-thiazole-5-carbonitrile;propane.
Molecular Properties
| Compound Name | methane;2-methyl-1,3-thiazole-5-carbonitrile;propane |
| PubChem CID | 142565775 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | methane;2-methyl-1,3-thiazole-5-carbonitrile;propane |
| SMILES | C.CCC.Cc1ncc(C#N)s1 |
| InChI | InChI=1S/C5H4N2S.C3H8.CH4/c1-4-7-3-5(2-6)8-4;1-3-2;/h3H,1H3;3H2,1-2H3;1H4 |
| InChIKey | DXFNAOHUMYMNJM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methane;2-methyl-1,3-thiazole-5-carbonitrile;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methyl-1,3-thiazole-5-carbonitrile;propane?
The IUPAC name of methane;2-methyl-1,3-thiazole-5-carbonitrile;propane (CID 142565775) is methane;2-methyl-1,3-thiazole-5-carbonitrile;propane.
What is the SMILES notation for methane;2-methyl-1,3-thiazole-5-carbonitrile;propane?
The canonical SMILES for methane;2-methyl-1,3-thiazole-5-carbonitrile;propane is C.CCC.Cc1ncc(C#N)s1.
What is the InChIKey of methane;2-methyl-1,3-thiazole-5-carbonitrile;propane?
The InChIKey is DXFNAOHUMYMNJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2S.C3H8.CH4/c1-4-7-3-5(2-6)8-4;1-3-2;/h3H,1H3;3H2,1-2H3;1H4.
What are the key properties of methane;2-methyl-1,3-thiazole-5-carbonitrile;propane?
methane;2-methyl-1,3-thiazole-5-carbonitrile;propane has a molecular weight of 184.31 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methyl-1,3-thiazole-5-carbonitrile;propane is sourced from PubChem (CID 142565775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).