C11H10F3N3OS — CID 142565795
2-methyl-2-[3-(1,3-thiazol-4-yl)-4-(trifluoromethyl)pyrazol-1-yl]propanal (PubChem CID 142565795) has the molecular formula C11H10F3N3OS and a molecular weight of 289.28 g/mol. Its IUPAC name is 2-methyl-2-[3-(1,3-thiazol-4-yl)-4-(trifluoromethyl)pyrazol-1-yl]propanal.
| Compound Name | 2-methyl-2-[3-(1,3-thiazol-4-yl)-4-(trifluoromethyl)pyrazol-1-yl]propanal |
|---|---|
| PubChem CID | 142565795 |
| Molecular Formula | C11H10F3N3OS |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-methyl-2-[3-(1,3-thiazol-4-yl)-4-(trifluoromethyl)pyrazol-1-yl]propanal |
| SMILES | CC(C)(C=O)n1cc(C(F)(F)F)c(-c2cscn2)n1 |
| InChI | InChI=1S/C11H10F3N3OS/c1-10(2,5-18)17-3-7(11(12,13)14)9(16-17)8-4-19-6-15-8/h3-6H,1-2H3 |
| InChIKey | NBINLDGWCPITNP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|