C13H14F2N2O — CID 142566148
3-(2,6-difluorophenyl)-4-methoxy-1-propan-2-ylpyrazole (PubChem CID 142566148) has the molecular formula C13H14F2N2O and a molecular weight of 252.26 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-4-methoxy-1-propan-2-ylpyrazole.
| Compound Name | 3-(2,6-difluorophenyl)-4-methoxy-1-propan-2-ylpyrazole |
|---|---|
| PubChem CID | 142566148 |
| Molecular Formula | C13H14F2N2O |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 3-(2,6-difluorophenyl)-4-methoxy-1-propan-2-ylpyrazole |
| SMILES | COc1cn(C(C)C)nc1-c1c(F)cccc1F |
| InChI | InChI=1S/C13H14F2N2O/c1-8(2)17-7-11(18-3)13(16-17)12-9(14)5-4-6-10(12)15/h4-8H,1-3H3 |
| InChIKey | LDMAJIMHONAPSC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |