C23H25F3N4O3S — CID 142566448
N-[2-(2,2-difluoroethyl)-3-fluorophenyl]-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide (PubChem CID 142566448) has the molecular formula C23H25F3N4O3S and a molecular weight of 494.54 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethyl)-3-fluorophenyl]-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide.
| Compound Name | N-[2-(2,2-difluoroethyl)-3-fluorophenyl]-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 142566448 |
| Molecular Formula | C23H25F3N4O3S |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-[2-(2,2-difluoroethyl)-3-fluorophenyl]-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide |
| SMILES | COCCOc1cnccc1CNC1=C(C(=S)Nc2cccc(F)c2CC(F)F)C(=O)NCC1 |
| InChI | InChI=1S/C23H25F3N4O3S/c1-32-9-10-33-19-13-27-7-5-14(19)12-29-18-6-8-28-22(31)21(18)23(34)30-17-4-2-3-16(24)15(17)11-20(25)26/h2-5,7,13,20,29H,6,8-12H2,1H3,(H,28,31)(H,30,34) |
| InChIKey | CVUBWSJXKZJAMZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|