C23H23F3N4O3 — CID 142566483
3-[2-(2,2-difluoroethyl)-3-fluoroanilino]-2-[3-(2-methoxyethoxy)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 142566483) has the molecular formula C23H23F3N4O3 and a molecular weight of 460.46 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethyl)-3-fluoroanilino]-2-[3-(2-methoxyethoxy)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 3-[2-(2,2-difluoroethyl)-3-fluoroanilino]-2-[3-(2-methoxyethoxy)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 142566483 |
| Molecular Formula | C23H23F3N4O3 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 3-[2-(2,2-difluoroethyl)-3-fluoroanilino]-2-[3-(2-methoxyethoxy)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | COCCOc1cnccc1-c1[nH]c2c(c1Nc1cccc(F)c1CC(F)F)C(=O)NCC2 |
| InChI | InChI=1S/C23H23F3N4O3/c1-32-9-10-33-18-12-27-7-5-13(18)21-22(20-17(30-21)6-8-28-23(20)31)29-16-4-2-3-15(24)14(16)11-19(25)26/h2-5,7,12,19,29-30H,6,8-11H2,1H3,(H,28,31) |
| InChIKey | MORBQWXWFNBSFY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|