C22H22F2N4O4 — CID 142566492
3-(3,4-difluoro-2-methoxyanilino)-2-[3-(2-methoxyethoxy)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 142566492) has the molecular formula C22H22F2N4O4 and a molecular weight of 444.44 g/mol. Its IUPAC name is 3-(3,4-difluoro-2-methoxyanilino)-2-[3-(2-methoxyethoxy)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 3-(3,4-difluoro-2-methoxyanilino)-2-[3-(2-methoxyethoxy)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 142566492 |
| Molecular Formula | C22H22F2N4O4 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 3-(3,4-difluoro-2-methoxyanilino)-2-[3-(2-methoxyethoxy)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | COCCOc1cnccc1-c1[nH]c2c(c1Nc1ccc(F)c(F)c1OC)C(=O)NCC2 |
| InChI | InChI=1S/C22H22F2N4O4/c1-30-9-10-32-16-11-25-7-5-12(16)19-20(17-14(27-19)6-8-26-22(17)29)28-15-4-3-13(23)18(24)21(15)31-2/h3-5,7,11,27-28H,6,8-10H2,1-2H3,(H,26,29) |
| InChIKey | ZQCYXRFWDZFUTC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|