C22H25FN4O3S — CID 142566497
N-(3-fluoro-2-methylphenyl)-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide (PubChem CID 142566497) has the molecular formula C22H25FN4O3S and a molecular weight of 444.53 g/mol. Its IUPAC name is N-(3-fluoro-2-methylphenyl)-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide.
| Compound Name | N-(3-fluoro-2-methylphenyl)-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 142566497 |
| Molecular Formula | C22H25FN4O3S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-(3-fluoro-2-methylphenyl)-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide |
| SMILES | COCCOc1cnccc1CNC1=C(C(=S)Nc2cccc(F)c2C)C(=O)NCC1 |
| InChI | InChI=1S/C22H25FN4O3S/c1-14-16(23)4-3-5-17(14)27-22(31)20-18(7-9-25-21(20)28)26-12-15-6-8-24-13-19(15)30-11-10-29-2/h3-6,8,13,26H,7,9-12H2,1-2H3,(H,25,28)(H,27,31) |
| InChIKey | JPNQRBLBCXKIMA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|