C23H24F2N4O3 — CID 142566526
3-[2-(2,2-difluoroethyl)anilino]-2-[3-(2-methoxyethoxy)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 142566526) has the molecular formula C23H24F2N4O3 and a molecular weight of 442.47 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethyl)anilino]-2-[3-(2-methoxyethoxy)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 3-[2-(2,2-difluoroethyl)anilino]-2-[3-(2-methoxyethoxy)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 142566526 |
| Molecular Formula | C23H24F2N4O3 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 3-[2-(2,2-difluoroethyl)anilino]-2-[3-(2-methoxyethoxy)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | COCCOc1cnccc1-c1[nH]c2c(c1Nc1ccccc1CC(F)F)C(=O)NCC2 |
| InChI | InChI=1S/C23H24F2N4O3/c1-31-10-11-32-18-13-26-8-6-15(18)21-22(20-17(29-21)7-9-27-23(20)30)28-16-5-3-2-4-14(16)12-19(24)25/h2-6,8,13,19,28-29H,7,9-12H2,1H3,(H,27,30) |
| InChIKey | HYKWEBPZLCNCSS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|