C6H10N2S — CID 142566575
1,2,3,6-tetrahydropyridine-5-carbothioamide (PubChem CID 142566575) has the molecular formula C6H10N2S and a molecular weight of 142.23 g/mol. Its IUPAC name is 1,2,3,6-tetrahydropyridine-5-carbothioamide.
| Compound Name | 1,2,3,6-tetrahydropyridine-5-carbothioamide |
|---|---|
| PubChem CID | 142566575 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 1,2,3,6-tetrahydropyridine-5-carbothioamide |
| SMILES | NC(=S)C1=CCCNC1 |
| InChI | InChI=1S/C6H10N2S/c7-6(9)5-2-1-3-8-4-5/h2,8H,1,3-4H2,(H2,7,9) |
| InChIKey | WEQDPSVVIBESNL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|