C23H38O3 — CID 142566710
methyl (2S)-2-[(2S,5S,14R,15S)-5-hydroxy-2,15-dimethyl-14-tricyclo[8.7.0.011,15]heptadec-1(17)-enyl]propanoate (PubChem CID 142566710) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is methyl (2S)-2-[(2S,5S,14R,15S)-5-hydroxy-2,15-dimethyl-14-tricyclo[8.7.0.011,15]heptadec-1(17)-enyl]propanoate.
| Compound Name | methyl (2S)-2-[(2S,5S,14R,15S)-5-hydroxy-2,15-dimethyl-14-tricyclo[8.7.0.011,15]heptadec-1(17)-enyl]propanoate |
|---|---|
| PubChem CID | 142566710 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | methyl (2S)-2-[(2S,5S,14R,15S)-5-hydroxy-2,15-dimethyl-14-tricyclo[8.7.0.011,15]heptadec-1(17)-enyl]propanoate |
| SMILES | COC(=O)[C@@H](C)[C@H]1CCC2C3CCCC[C@H](O)CC[C@H](C)C3=CC[C@@]21C |
| InChI | InChI=1S/C23H38O3/c1-15-9-10-17(24)7-5-6-8-19-18(15)13-14-23(3)20(11-12-21(19)23)16(2)22(25)26-4/h13,15-17,19-21,24H,5-12,14H2,1-4H3/t15-,16-,17-,19?,20+,21?,23+/m0/s1 |
| InChIKey | TZTZHALKQQRTHH-PVKGENPSSA-N |
| XLogP | 5.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|