C50H38N2O — CID 142568052
6-carbazol-9-yl-1-[3-(3-dibenzofuran-1-ylphenyl)phenyl]-9H-carbazole;ethane;molecular hydrogen (PubChem CID 142568052) has the molecular formula C50H38N2O and a molecular weight of 682.87 g/mol. Its IUPAC name is 6-carbazol-9-yl-1-[3-(3-dibenzofuran-1-ylphenyl)phenyl]-9H-carbazole;ethane;molecular hydrogen.
| Compound Name | 6-carbazol-9-yl-1-[3-(3-dibenzofuran-1-ylphenyl)phenyl]-9H-carbazole;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 142568052 |
| Molecular Formula | C50H38N2O |
| Molecular Weight | 682.87 g/mol |
| Exact Mass | 682.30 |
| IUPAC Name | 6-carbazol-9-yl-1-[3-(3-dibenzofuran-1-ylphenyl)phenyl]-9H-carbazole;ethane;molecular hydrogen |
| SMILES | CC.[H][H].c1cc(-c2cccc(-c3cccc4oc5ccccc5c34)c2)cc(-c2cccc3c2[nH]c2ccc(-n4c5ccccc5c5ccccc54)cc23)c1 |
| InChI | InChI=1S/C48H30N2O.C2H6.H2/c1-4-21-43-37(15-1)38-16-2-5-22-44(38)50(43)34-25-26-42-41(29-34)39-20-9-19-36(48(39)49-42)33-14-8-12-31(28-33)30-11-7-13-32(27-30)35-18-10-24-46-47(35)40-17-3-6-23-45(40)51-46;1-2;/h1-29,49H;1-2H3;1H |
| InChIKey | UYFCWRLBRYBDJK-UHFFFAOYSA-N |
| XLogP | 14.59 |
| TPSA | 33.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.87 |
| LogP ≤ 5 | 14.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |