About ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone
ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone (PubChem CID 142572417) has the molecular formula C11H23NO3
and a molecular weight of 217.31 g/mol. Its IUPAC name is ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone.
Molecular Properties
| Compound Name | ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone |
| PubChem CID | 142572417 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone |
| SMILES | CC.CC(=O)N1CCCC1C.COC=O |
| InChI | InChI=1S/C7H13NO.C2H4O2.C2H6/c1-6-4-3-5-8(6)7(2)9;1-4-2-3;1-2/h6H,3-5H2,1-2H3;2H,1H3;1-2H3 |
| InChIKey | XDHATDOWMWVQID-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone?
The IUPAC name of ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone (CID 142572417) is ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone.
What is the SMILES notation for ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone?
The canonical SMILES for ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone is CC.CC(=O)N1CCCC1C.COC=O.
What is the InChIKey of ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone?
The InChIKey is XDHATDOWMWVQID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C2H4O2.C2H6/c1-6-4-3-5-8(6)7(2)9;1-4-2-3;1-2/h6H,3-5H2,1-2H3;2H,1H3;1-2H3.
What are the key properties of ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone?
ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone has a molecular weight of 217.31 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl formate;1-(2-methylpyrrolidin-1-yl)ethanone is sourced from PubChem (CID 142572417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).