C16H27N5O2 — CID 142572642
N'-(ethylamino)-1-[3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butanoyl]pyrrolidine-2-carboximidamide (PubChem CID 142572642) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is N'-(ethylamino)-1-[3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butanoyl]pyrrolidine-2-carboximidamide.
| Compound Name | N'-(ethylamino)-1-[3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butanoyl]pyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 142572642 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | N'-(ethylamino)-1-[3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butanoyl]pyrrolidine-2-carboximidamide |
| SMILES | CCN/N=C(\N)C1CCCN1C(=O)C(c1cc(C)no1)C(C)C |
| InChI | InChI=1S/C16H27N5O2/c1-5-18-19-15(17)12-7-6-8-21(12)16(22)14(10(2)3)13-9-11(4)20-23-13/h9-10,12,14,18H,5-8H2,1-4H3,(H2,17,19) |
| InChIKey | IRFWBTGUEHTBED-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|