C22H25F3N4O4 — CID 142572894
(2R)-1-[(2S,4R)-4-hydroxy-2-[(5S)-5-phenyl-5-(trifluoromethyl)-2H-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]-3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butan-1-one (PubChem CID 142572894) has the molecular formula C22H25F3N4O4 and a molecular weight of 466.46 g/mol. Its IUPAC name is (2R)-1-[(2S,4R)-4-hydroxy-2-[(5S)-5-phenyl-5-(trifluoromethyl)-2H-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]-3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butan-1-one.
| Compound Name | (2R)-1-[(2S,4R)-4-hydroxy-2-[(5S)-5-phenyl-5-(trifluoromethyl)-2H-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]-3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butan-1-one |
|---|---|
| PubChem CID | 142572894 |
| Molecular Formula | C22H25F3N4O4 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | (2R)-1-[(2S,4R)-4-hydroxy-2-[(5S)-5-phenyl-5-(trifluoromethyl)-2H-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]-3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butan-1-one |
| SMILES | Cc1cc([C@H](C(=O)N2C[C@H](O)C[C@H]2C2=N[C@](c3ccccc3)(C(F)(F)F)ON2)C(C)C)on1 |
| InChI | InChI=1S/C22H25F3N4O4/c1-12(2)18(17-9-13(3)27-32-17)20(31)29-11-15(30)10-16(29)19-26-21(33-28-19,22(23,24)25)14-7-5-4-6-8-14/h4-9,12,15-16,18,30H,10-11H2,1-3H3,(H,26,28)/t15-,16+,18-,21+/m1/s1 |
| InChIKey | VNNBFHMSXBWONC-AWQBJMPUSA-N |
| XLogP | 3.03 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |