C18H31N3O4 — CID 142573256
1-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]-N-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxamide;propane (PubChem CID 142573256) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is 1-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]-N-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxamide;propane.
| Compound Name | 1-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]-N-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxamide;propane |
|---|---|
| PubChem CID | 142573256 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 1-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]-N-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxamide;propane |
| SMILES | CCC.Cc1cc(CC(=O)N2CCCC2C(=O)NOC(C)(C)C)on1 |
| InChI | InChI=1S/C15H23N3O4.C3H8/c1-10-8-11(21-16-10)9-13(19)18-7-5-6-12(18)14(20)17-22-15(2,3)4;1-3-2/h8,12H,5-7,9H2,1-4H3,(H,17,20);3H2,1-2H3 |
| InChIKey | WLPSQRTVHKYVRC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|