C29H39N5OS — CID 142573395
3-(2-ethoxyphenyl)-9-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-3,9-diazaspiro[5.5]undecane (PubChem CID 142573395) has the molecular formula C29H39N5OS and a molecular weight of 505.73 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-9-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-(2-ethoxyphenyl)-9-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 142573395 |
| Molecular Formula | C29H39N5OS |
| Molecular Weight | 505.73 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 3-(2-ethoxyphenyl)-9-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-3,9-diazaspiro[5.5]undecane |
| SMILES | CCOc1ccccc1N1CCC2(CCN(CCCSc3nnc(-c4ccccc4)n3C)CC2)CC1 |
| InChI | InChI=1S/C29H39N5OS/c1-3-35-26-13-8-7-12-25(26)34-21-16-29(17-22-34)14-19-33(20-15-29)18-9-23-36-28-31-30-27(32(28)2)24-10-5-4-6-11-24/h4-8,10-13H,3,9,14-23H2,1-2H3 |
| InChIKey | UAYHHCOSZYIZOH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.73 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|