C18H22N2O4 — CID 142573618
1-[2-[[(6Z)-deca-3,4,6-trien-9-ynoyl]amino]acetyl]piperidine-4-carboxylic acid (PubChem CID 142573618) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-[2-[[(6Z)-deca-3,4,6-trien-9-ynoyl]amino]acetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[[(6Z)-deca-3,4,6-trien-9-ynoyl]amino]acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 142573618 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[2-[[(6Z)-deca-3,4,6-trien-9-ynoyl]amino]acetyl]piperidine-4-carboxylic acid |
| SMILES | C#CC/C=C\C=C=CCC(=O)NCC(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C18H22N2O4/c1-2-3-4-5-6-7-8-9-16(21)19-14-17(22)20-12-10-15(11-13-20)18(23)24/h1,4-6,8,15H,3,9-14H2,(H,19,21)(H,23,24)/b5-4- |
| InChIKey | OVPJUJJNRHEZOB-PLNGDYQASA-N |
| XLogP | 1.11 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|