C31H50O7Si — CID 14257364
1-O-[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 3-O-methyl 2,2-dimethylpropanedioate (PubChem CID 14257364) has the molecular formula C31H50O7Si and a molecular weight of 562.82 g/mol. Its IUPAC name is 1-O-[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 3-O-methyl 2,2-dimethylpropanedioate.
| Compound Name | 1-O-[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 3-O-methyl 2,2-dimethylpropanedioate |
|---|---|
| PubChem CID | 14257364 |
| Molecular Formula | C31H50O7Si |
| Molecular Weight | 562.82 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | 1-O-[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 3-O-methyl 2,2-dimethylpropanedioate |
| SMILES | COC(=O)C(C)(C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C31H50O7Si/c1-19-15-21-12-11-20(2)24(27(21)25(16-19)37-29(34)31(6,7)28(33)35-8)14-13-22-17-23(18-26(32)36-22)38-39(9,10)30(3,4)5/h11-12,15,19-20,22-25,27H,13-14,16-18H2,1-10H3/t19-,20-,22+,23+,24-,25-,27-/m0/s1 |
| InChIKey | ZFUPXOWYRXVUOD-SSFSUTQVSA-N |
| XLogP | 6.38 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.82 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|