About pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate
pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate (PubChem CID 142574177) has the molecular formula C19H11Cl2F3N2O2
and a molecular weight of 427.21 g/mol. Its IUPAC name is pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate |
| PubChem CID | 142574177 |
| Molecular Formula | C19H11Cl2F3N2O2 |
| Molecular Weight | 427.21 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate |
| SMILES | O=C(OCc1ccccn1)c1nc(-c2ccc(C(F)(F)F)cc2Cl)ccc1Cl |
| InChI | InChI=1S/C19H11Cl2F3N2O2/c20-14-6-7-16(13-5-4-11(9-15(13)21)19(22,23)24)26-17(14)18(27)28-10-12-3-1-2-8-25-12/h1-9H,10H2 |
| InChIKey | OXZQJDHEUVXFTI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.21 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate?
The IUPAC name of pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate (CID 142574177) is pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate.
What is the SMILES notation for pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate?
The canonical SMILES for pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate is O=C(OCc1ccccn1)c1nc(-c2ccc(C(F)(F)F)cc2Cl)ccc1Cl.
What is the InChIKey of pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate?
The InChIKey is OXZQJDHEUVXFTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11Cl2F3N2O2/c20-14-6-7-16(13-5-4-11(9-15(13)21)19(22,23)24)26-17(14)18(27)28-10-12-3-1-2-8-25-12/h1-9H,10H2.
What are the key properties of pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate?
pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate has a molecular weight of 427.21 g/mol, XLogP of 5.83, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl 3-chloro-6-[2-chloro-4-(trifluoromethyl)phenyl]pyridine-2-carboxylate is sourced from PubChem (CID 142574177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).