C16H25N5O2 — CID 142574873
N-[5-amino-1-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)pentyl]acetamide;ethane (PubChem CID 142574873) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[5-amino-1-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)pentyl]acetamide;ethane.
| Compound Name | N-[5-amino-1-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)pentyl]acetamide;ethane |
|---|---|
| PubChem CID | 142574873 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | N-[5-amino-1-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)pentyl]acetamide;ethane |
| SMILES | CC.CC(=O)NC(CCCCN)c1nnc(-c2ccccn2)o1 |
| InChI | InChI=1S/C14H19N5O2.C2H6/c1-10(20)17-12(7-2-4-8-15)14-19-18-13(21-14)11-6-3-5-9-16-11;1-2/h3,5-6,9,12H,2,4,7-8,15H2,1H3,(H,17,20);1-2H3 |
| InChIKey | WWTPGCOCPOAEJG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|