C20H30N4OS — CID 142574877
N-[2-(4-aminophenyl)-1-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)ethyl]acetamide;ethane (PubChem CID 142574877) has the molecular formula C20H30N4OS and a molecular weight of 374.55 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)-1-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)ethyl]acetamide;ethane.
| Compound Name | N-[2-(4-aminophenyl)-1-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)ethyl]acetamide;ethane |
|---|---|
| PubChem CID | 142574877 |
| Molecular Formula | C20H30N4OS |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | N-[2-(4-aminophenyl)-1-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)ethyl]acetamide;ethane |
| SMILES | CC.CC(=O)NC(Cc1ccc(N)cc1)c1nnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C18H24N4OS.C2H6/c1-12(23)20-16(11-13-7-9-15(19)10-8-13)18-22-21-17(24-18)14-5-3-2-4-6-14;1-2/h7-10,14,16H,2-6,11,19H2,1H3,(H,20,23);1-2H3 |
| InChIKey | JDGIDLZMAFPENZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|