C14H17ClN4O3 — CID 14257490
6-chloro-4-N-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 14257490) has the molecular formula C14H17ClN4O3 and a molecular weight of 324.77 g/mol. Its IUPAC name is 6-chloro-4-N-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 14257490 |
| Molecular Formula | C14H17ClN4O3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 6-chloro-4-N-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(CNc2cc(Cl)nc(N)n2)cc(OC)c1OC |
| InChI | InChI=1S/C14H17ClN4O3/c1-20-9-4-8(5-10(21-2)13(9)22-3)7-17-12-6-11(15)18-14(16)19-12/h4-6H,7H2,1-3H3,(H3,16,17,18,19) |
| InChIKey | ACUPESADEROOOP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |