C15H24N6O2 — CID 142574902
N-[5-amino-1-(5-pyrimidin-4-yl-1,3,4-oxadiazol-2-yl)pentyl]acetamide;ethane (PubChem CID 142574902) has the molecular formula C15H24N6O2 and a molecular weight of 320.40 g/mol. Its IUPAC name is N-[5-amino-1-(5-pyrimidin-4-yl-1,3,4-oxadiazol-2-yl)pentyl]acetamide;ethane.
| Compound Name | N-[5-amino-1-(5-pyrimidin-4-yl-1,3,4-oxadiazol-2-yl)pentyl]acetamide;ethane |
|---|---|
| PubChem CID | 142574902 |
| Molecular Formula | C15H24N6O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | N-[5-amino-1-(5-pyrimidin-4-yl-1,3,4-oxadiazol-2-yl)pentyl]acetamide;ethane |
| SMILES | CC.CC(=O)NC(CCCCN)c1nnc(-c2ccncn2)o1 |
| InChI | InChI=1S/C13H18N6O2.C2H6/c1-9(20)17-11(4-2-3-6-14)13-19-18-12(21-13)10-5-7-15-8-16-10;1-2/h5,7-8,11H,2-4,6,14H2,1H3,(H,17,20);1-2H3 |
| InChIKey | AYXVSVIOIFLGQX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|