About N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine
N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine (PubChem CID 142575126) has the molecular formula C13H12N4S
and a molecular weight of 256.33 g/mol. Its IUPAC name is N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine.
Molecular Properties
| Compound Name | N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine |
| PubChem CID | 142575126 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine |
| SMILES | CNc1cc2cc(-c3nnc(C)s3)ccc2cn1 |
| InChI | InChI=1S/C13H12N4S/c1-8-16-17-13(18-8)9-3-4-10-7-15-12(14-2)6-11(10)5-9/h3-7H,1-2H3,(H,14,15) |
| InChIKey | NOEYIDTZZSYLML-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine?
The IUPAC name of N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine (CID 142575126) is N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine.
What is the SMILES notation for N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine?
The canonical SMILES for N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine is CNc1cc2cc(-c3nnc(C)s3)ccc2cn1.
What is the InChIKey of N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine?
The InChIKey is NOEYIDTZZSYLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4S/c1-8-16-17-13(18-8)9-3-4-10-7-15-12(14-2)6-11(10)5-9/h3-7H,1-2H3,(H,14,15).
What are the key properties of N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine?
N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine has a molecular weight of 256.33 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-(5-methyl-1,3,4-thiadiazol-2-yl)isoquinolin-3-amine is sourced from PubChem (CID 142575126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).