C20H23N5O2 — CID 142575534
2-[ethyl(2-methoxyethyl)amino]-N-(6-pyridazin-4-ylisoquinolin-3-yl)acetamide (PubChem CID 142575534) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-[ethyl(2-methoxyethyl)amino]-N-(6-pyridazin-4-ylisoquinolin-3-yl)acetamide.
| Compound Name | 2-[ethyl(2-methoxyethyl)amino]-N-(6-pyridazin-4-ylisoquinolin-3-yl)acetamide |
|---|---|
| PubChem CID | 142575534 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[ethyl(2-methoxyethyl)amino]-N-(6-pyridazin-4-ylisoquinolin-3-yl)acetamide |
| SMILES | CCN(CCOC)CC(=O)Nc1cc2cc(-c3ccnnc3)ccc2cn1 |
| InChI | InChI=1S/C20H23N5O2/c1-3-25(8-9-27-2)14-20(26)24-19-11-18-10-15(4-5-16(18)12-21-19)17-6-7-22-23-13-17/h4-7,10-13H,3,8-9,14H2,1-2H3,(H,21,24,26) |
| InChIKey | MRJWEKIIBLPOAR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |