About platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine)
platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine) (PubChem CID 142576013) has the molecular formula C22H16N8Pt
and a molecular weight of 587.50 g/mol. Its IUPAC name is platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine).
Molecular Properties
| Compound Name | platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine) |
| PubChem CID | 142576013 |
| Molecular Formula | C22H16N8Pt |
| Molecular Weight | 587.50 g/mol |
| Exact Mass | 587.11 |
| IUPAC Name | platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine) |
| SMILES | [Pt].c1ccc(-c2nnc3ccccn23)nc1.c1ccc(-c2nnc3ccccn23)nc1 |
| InChI | InChI=1S/2C11H8N4.Pt/c2*1-3-7-12-9(5-1)11-14-13-10-6-2-4-8-15(10)11;/h2*1-8H; |
| InChIKey | IXVVLKTXSOTSCD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 86.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 587.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine)?
The IUPAC name of platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine) (CID 142576013) is platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine).
What is the SMILES notation for platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine)?
The canonical SMILES for platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine) is [Pt].c1ccc(-c2nnc3ccccn23)nc1.c1ccc(-c2nnc3ccccn23)nc1.
What is the InChIKey of platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine)?
The InChIKey is IXVVLKTXSOTSCD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H8N4.Pt/c2*1-3-7-12-9(5-1)11-14-13-10-6-2-4-8-15(10)11;/h2*1-8H;.
What are the key properties of platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine)?
platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine) has a molecular weight of 587.50 g/mol, XLogP of 3.58, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;bis(3-pyridin-2-yl-[1,2,4]triazolo[4,3-a]pyridine) is sourced from PubChem (CID 142576013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).