C11H15F2N3S — CID 142576166
N-[(3,3-difluorocyclobutyl)methyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-amine (PubChem CID 142576166) has the molecular formula C11H15F2N3S and a molecular weight of 259.32 g/mol. Its IUPAC name is N-[(3,3-difluorocyclobutyl)methyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-amine.
| Compound Name | N-[(3,3-difluorocyclobutyl)methyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-amine |
|---|---|
| PubChem CID | 142576166 |
| Molecular Formula | C11H15F2N3S |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-[(3,3-difluorocyclobutyl)methyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-amine |
| SMILES | FC1(F)CC(CNc2nc3c(s2)CNCC3)C1 |
| InChI | InChI=1S/C11H15F2N3S/c12-11(13)3-7(4-11)5-15-10-16-8-1-2-14-6-9(8)17-10/h7,14H,1-6H2,(H,15,16) |
| InChIKey | AWBIRIQLJAIPQT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |