About ethane;methyl 2-morpholin-3-ylacetate
ethane;methyl 2-morpholin-3-ylacetate (PubChem CID 142578691) has the molecular formula C9H19NO3
and a molecular weight of 189.25 g/mol. Its IUPAC name is ethane;methyl 2-morpholin-3-ylacetate.
Molecular Properties
| Compound Name | ethane;methyl 2-morpholin-3-ylacetate |
| PubChem CID | 142578691 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | ethane;methyl 2-morpholin-3-ylacetate |
| SMILES | CC.COC(=O)CC1COCCN1 |
| InChI | InChI=1S/C7H13NO3.C2H6/c1-10-7(9)4-6-5-11-3-2-8-6;1-2/h6,8H,2-5H2,1H3;1-2H3 |
| InChIKey | YNLHYDMPSZTRCB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;methyl 2-morpholin-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 2-morpholin-3-ylacetate?
The IUPAC name of ethane;methyl 2-morpholin-3-ylacetate (CID 142578691) is ethane;methyl 2-morpholin-3-ylacetate.
What is the SMILES notation for ethane;methyl 2-morpholin-3-ylacetate?
The canonical SMILES for ethane;methyl 2-morpholin-3-ylacetate is CC.COC(=O)CC1COCCN1.
What is the InChIKey of ethane;methyl 2-morpholin-3-ylacetate?
The InChIKey is YNLHYDMPSZTRCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3.C2H6/c1-10-7(9)4-6-5-11-3-2-8-6;1-2/h6,8H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;methyl 2-morpholin-3-ylacetate?
ethane;methyl 2-morpholin-3-ylacetate has a molecular weight of 189.25 g/mol, XLogP of 0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 2-morpholin-3-ylacetate is sourced from PubChem (CID 142578691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).