C15H19ClN6O3 — CID 14257884
4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N'-methylbenzenecarboximidamide;hydrate;hydrochloride (PubChem CID 14257884) has the molecular formula C15H19ClN6O3 and a molecular weight of 366.81 g/mol. Its IUPAC name is 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N'-methylbenzenecarboximidamide;hydrate;hydrochloride.
| Compound Name | 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N'-methylbenzenecarboximidamide;hydrate;hydrochloride |
|---|---|
| PubChem CID | 14257884 |
| Molecular Formula | C15H19ClN6O3 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)-N'-methylbenzenecarboximidamide;hydrate;hydrochloride |
| SMILES | C/N=C(\N)c1ccc(-c2nc3c([nH]2)c(=O)n(C)c(=O)n3C)cc1.Cl.O |
| InChI | InChI=1S/C15H16N6O2.ClH.H2O/c1-17-11(16)8-4-6-9(7-5-8)12-18-10-13(19-12)20(2)15(23)21(3)14(10)22;;/h4-7H,1-3H3,(H2,16,17)(H,18,19);1H;1H2 |
| InChIKey | IRACZOUSVHMSDD-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 142.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|