C31H59NO12 — CID 142579008
ditert-butyl 2-[2-[2-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]butanedioate (PubChem CID 142579008) has the molecular formula C31H59NO12 and a molecular weight of 637.81 g/mol. Its IUPAC name is ditert-butyl 2-[2-[2-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]butanedioate.
| Compound Name | ditert-butyl 2-[2-[2-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]butanedioate |
|---|---|
| PubChem CID | 142579008 |
| Molecular Formula | C31H59NO12 |
| Molecular Weight | 637.81 g/mol |
| Exact Mass | 637.40 |
| IUPAC Name | ditert-butyl 2-[2-[2-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCNC(CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H59NO12/c1-29(2,3)42-26(33)10-12-36-14-16-38-18-20-40-22-23-41-21-19-39-17-15-37-13-11-32-25(28(35)44-31(7,8)9)24-27(34)43-30(4,5)6/h25,32H,10-24H2,1-9H3 |
| InChIKey | UBIQFRKCFZOCHZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 146.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.81 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|