About N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine
N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine (PubChem CID 142579372) has the molecular formula C22H30BrF2N3
and a molecular weight of 454.40 g/mol. Its IUPAC name is N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine.
Molecular Properties
| Compound Name | N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine |
| PubChem CID | 142579372 |
| Molecular Formula | C22H30BrF2N3 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine |
| SMILES | FC1(F)CCC(Cn2cc(CCNC3CCNCC3)c3cc(Br)ccc32)CC1 |
| InChI | InChI=1S/C22H30BrF2N3/c23-18-1-2-21-20(13-18)17(5-12-27-19-6-10-26-11-7-19)15-28(21)14-16-3-8-22(24,25)9-4-16/h1-2,13,15-16,19,26-27H,3-12,14H2 |
| InChIKey | PIBADKIRXIUTJX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 28.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine?
The IUPAC name of N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine (CID 142579372) is N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine.
What is the SMILES notation for N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine?
The canonical SMILES for N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine is FC1(F)CCC(Cn2cc(CCNC3CCNCC3)c3cc(Br)ccc32)CC1.
What is the InChIKey of N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine?
The InChIKey is PIBADKIRXIUTJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30BrF2N3/c23-18-1-2-21-20(13-18)17(5-12-27-19-6-10-26-11-7-19)15-28(21)14-16-3-8-22(24,25)9-4-16/h1-2,13,15-16,19,26-27H,3-12,14H2.
What are the key properties of N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine?
N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine has a molecular weight of 454.40 g/mol, XLogP of 5.11, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[5-bromo-1-[(4,4-difluorocyclohexyl)methyl]indol-3-yl]ethyl]piperidin-4-amine is sourced from PubChem (CID 142579372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).