C14H19N5O3 — CID 142579913
7-(methoxymethyl)-11-propan-2-yloxy-9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,4,11,13-pentaen-5-amine (PubChem CID 142579913) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is 7-(methoxymethyl)-11-propan-2-yloxy-9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,4,11,13-pentaen-5-amine.
| Compound Name | 7-(methoxymethyl)-11-propan-2-yloxy-9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,4,11,13-pentaen-5-amine |
|---|---|
| PubChem CID | 142579913 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 7-(methoxymethyl)-11-propan-2-yloxy-9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,4,11,13-pentaen-5-amine |
| SMILES | COCC1COc2c(ccnc2OC(C)C)-c2nnc(N)n21 |
| InChI | InChI=1S/C14H19N5O3/c1-8(2)22-13-11-10(4-5-16-13)12-17-18-14(15)19(12)9(6-20-3)7-21-11/h4-5,8-9H,6-7H2,1-3H3,(H2,15,18) |
| InChIKey | VJZIHOLAZICDBQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |