C12H16N2O — CID 142580280
2-(5-methyl-7,8-dihydro-6H-1,5-naphthyridin-2-yl)propanal (PubChem CID 142580280) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(5-methyl-7,8-dihydro-6H-1,5-naphthyridin-2-yl)propanal.
| Compound Name | 2-(5-methyl-7,8-dihydro-6H-1,5-naphthyridin-2-yl)propanal |
|---|---|
| PubChem CID | 142580280 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-(5-methyl-7,8-dihydro-6H-1,5-naphthyridin-2-yl)propanal |
| SMILES | CC(C=O)c1ccc2c(n1)CCCN2C |
| InChI | InChI=1S/C12H16N2O/c1-9(8-15)10-5-6-12-11(13-10)4-3-7-14(12)2/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | PZZXRMLBYGWSDS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|