About (8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one
(8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one (PubChem CID 142580696) has the molecular formula C13H19NO4
and a molecular weight of 253.30 g/mol. Its IUPAC name is (8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one.
Molecular Properties
| Compound Name | (8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one |
| PubChem CID | 142580696 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one |
| SMILES | C=C1/C=C/COCCOCN2C(=O)CCC2CO1 |
| InChI | InChI=1S/C13H19NO4/c1-11-3-2-6-16-7-8-17-10-14-12(9-18-11)4-5-13(14)15/h2-3,12H,1,4-10H2/b3-2+ |
| InChIKey | QCLOPJRGYGTBRI-NSCUHMNNSA-N |
| XLogP | 1.07 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one?
The IUPAC name of (8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one (CID 142580696) is (8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one.
What is the SMILES notation for (8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one?
The canonical SMILES for (8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one is C=C1/C=C/COCCOCN2C(=O)CCC2CO1.
What is the InChIKey of (8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one?
The InChIKey is QCLOPJRGYGTBRI-NSCUHMNNSA-N. The full InChI is InChI=1S/C13H19NO4/c1-11-3-2-6-16-7-8-17-10-14-12(9-18-11)4-5-13(14)15/h2-3,12H,1,4-10H2/b3-2+.
What are the key properties of (8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one?
(8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one has a molecular weight of 253.30 g/mol, XLogP of 1.07, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8E)-10-methylidene-3,6,11-trioxa-1-azabicyclo[11.3.0]hexadec-8-en-16-one is sourced from PubChem (CID 142580696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).