About 5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine
5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine (PubChem CID 142582350) has the molecular formula C7H6ClN3OS
and a molecular weight of 215.67 g/mol. Its IUPAC name is 5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| PubChem CID | 142582350 |
| Molecular Formula | C7H6ClN3OS |
| Molecular Weight | 215.67 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| SMILES | COc1cc(Cl)nc2sc(N)nc12 |
| InChI | InChI=1S/C7H6ClN3OS/c1-12-3-2-4(8)10-6-5(3)11-7(9)13-6/h2H,1H3,(H2,9,11) |
| InChIKey | QMZIGNRKLVVQIB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.67 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine?
The IUPAC name of 5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine (CID 142582350) is 5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine.
What is the SMILES notation for 5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine?
The canonical SMILES for 5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine is COc1cc(Cl)nc2sc(N)nc12.
What is the InChIKey of 5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine?
The InChIKey is QMZIGNRKLVVQIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3OS/c1-12-3-2-4(8)10-6-5(3)11-7(9)13-6/h2H,1H3,(H2,9,11).
What are the key properties of 5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine?
5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine has a molecular weight of 215.67 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-7-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-amine is sourced from PubChem (CID 142582350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).