C24H38N6 — CID 142582623
N-[2-[2-(3,3-dimethylbutyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]ethyl]-6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-amine (PubChem CID 142582623) has the molecular formula C24H38N6 and a molecular weight of 410.61 g/mol. Its IUPAC name is N-[2-[2-(3,3-dimethylbutyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]ethyl]-6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-amine.
| Compound Name | N-[2-[2-(3,3-dimethylbutyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]ethyl]-6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 142582623 |
| Molecular Formula | C24H38N6 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | N-[2-[2-(3,3-dimethylbutyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]ethyl]-6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-amine |
| SMILES | Cc1cnn(C)c1-c1ccc(NCCC2CCC3CN(CCC(C)(C)C)CC23)nn1 |
| InChI | InChI=1S/C24H38N6/c1-17-14-26-29(5)23(17)21-8-9-22(28-27-21)25-12-10-18-6-7-19-15-30(16-20(18)19)13-11-24(2,3)4/h8-9,14,18-20H,6-7,10-13,15-16H2,1-5H3,(H,25,28) |
| InChIKey | OMRVULPVOYRUFK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |