C38H60N4O10 — CID 142583368
N-[2-(2-ethenoxyethoxy)ethyl]-4-[(4-methylidenecyclohexanecarbonyl)amino]-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-N'-[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide (PubChem CID 142583368) has the molecular formula C38H60N4O10 and a molecular weight of 732.92 g/mol. Its IUPAC name is N-[2-(2-ethenoxyethoxy)ethyl]-4-[(4-methylidenecyclohexanecarbonyl)amino]-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-N'-[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide.
| Compound Name | N-[2-(2-ethenoxyethoxy)ethyl]-4-[(4-methylidenecyclohexanecarbonyl)amino]-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-N'-[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide |
|---|---|
| PubChem CID | 142583368 |
| Molecular Formula | C38H60N4O10 |
| Molecular Weight | 732.92 g/mol |
| Exact Mass | 732.43 |
| IUPAC Name | N-[2-(2-ethenoxyethoxy)ethyl]-4-[(4-methylidenecyclohexanecarbonyl)amino]-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-N'-[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide |
| SMILES | C#CCOCCOCCNC(=O)CCC(CCC(=O)NCCOCCOC=C)(CCC(=O)NCCOCCOCC#C)NC(=O)C1CCC(=C)CC1 |
| InChI | InChI=1S/C38H60N4O10/c1-5-21-48-28-30-51-24-19-40-35(44)13-16-38(42-37(46)33-10-8-32(4)9-11-33,15-12-34(43)39-18-23-50-27-26-47-7-3)17-14-36(45)41-20-25-52-31-29-49-22-6-2/h1-2,7,33H,3-4,8-31H2,(H,39,43)(H,40,44)(H,41,45)(H,42,46) |
| InChIKey | RVPQRRZIKYFSFD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 171.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.92 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|