C28H33N5O2 — CID 142584070
7-[(Z)-1-[(E)-but-1-enoxy]prop-1-enyl]-N-methylquinazolin-2-amine;2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyridine-4-carbaldehyde (PubChem CID 142584070) has the molecular formula C28H33N5O2 and a molecular weight of 471.61 g/mol. Its IUPAC name is 7-[(Z)-1-[(E)-but-1-enoxy]prop-1-enyl]-N-methylquinazolin-2-amine;2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyridine-4-carbaldehyde.
| Compound Name | 7-[(Z)-1-[(E)-but-1-enoxy]prop-1-enyl]-N-methylquinazolin-2-amine;2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 142584070 |
| Molecular Formula | C28H33N5O2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 7-[(Z)-1-[(E)-but-1-enoxy]prop-1-enyl]-N-methylquinazolin-2-amine;2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyridine-4-carbaldehyde |
| SMILES | C/C=C(\O/C=C/CC)c1ccc2cnc(NC)nc2c1.CN1CC=C(c2cc(C=O)ccn2)CC1 |
| InChI | InChI=1S/C16H19N3O.C12H14N2O/c1-4-6-9-20-15(5-2)12-7-8-13-11-18-16(17-3)19-14(13)10-12;1-14-6-3-11(4-7-14)12-8-10(9-15)2-5-13-12/h5-11H,4H2,1-3H3,(H,17,18,19);2-3,5,8-9H,4,6-7H2,1H3/b9-6+,15-5-; |
| InChIKey | PYRVETUTBLZIIU-JSLJTYRQSA-N |
| XLogP | 5.59 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|